About (8-fluoro-2-methylocta-4,5-dien-2-yl)benzene
(8-fluoro-2-methylocta-4,5-dien-2-yl)benzene (PubChem CID 102169993) has the molecular formula C15H19F
and a molecular weight of 218.31 g/mol. Its IUPAC name is (8-fluoro-2-methylocta-4,5-dien-2-yl)benzene.
Molecular Properties
| Compound Name | (8-fluoro-2-methylocta-4,5-dien-2-yl)benzene |
| PubChem CID | 102169993 |
| Molecular Formula | C15H19F |
| Molecular Weight | 218.31 g/mol |
| Exact Mass | 218.15 |
| IUPAC Name | (8-fluoro-2-methylocta-4,5-dien-2-yl)benzene |
| SMILES | CC(C)(CC=C=CCCF)c1ccccc1 |
| InChI | InChI=1S/C15H19F/c1-15(2,12-8-3-4-9-13-16)14-10-6-5-7-11-14/h4-8,10-11H,9,12-13H2,1-2H3 |
| InChIKey | SQCHQRSWNJVCNA-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.31 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze (8-fluoro-2-methylocta-4,5-dien-2-yl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (8-fluoro-2-methylocta-4,5-dien-2-yl)benzene?
The IUPAC name of (8-fluoro-2-methylocta-4,5-dien-2-yl)benzene (CID 102169993) is (8-fluoro-2-methylocta-4,5-dien-2-yl)benzene.
What is the SMILES notation for (8-fluoro-2-methylocta-4,5-dien-2-yl)benzene?
The canonical SMILES for (8-fluoro-2-methylocta-4,5-dien-2-yl)benzene is CC(C)(CC=C=CCCF)c1ccccc1.
What is the InChIKey of (8-fluoro-2-methylocta-4,5-dien-2-yl)benzene?
The InChIKey is SQCHQRSWNJVCNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19F/c1-15(2,12-8-3-4-9-13-16)14-10-6-5-7-11-14/h4-8,10-11H,9,12-13H2,1-2H3.
What are the key properties of (8-fluoro-2-methylocta-4,5-dien-2-yl)benzene?
(8-fluoro-2-methylocta-4,5-dien-2-yl)benzene has a molecular weight of 218.31 g/mol, XLogP of 4.43, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (8-fluoro-2-methylocta-4,5-dien-2-yl)benzene is sourced from PubChem (CID 102169993), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).