C19H18ClN3O2 — CID 118053030
2-amino-7-(3-chlorophenyl)-3-(oxolan-2-ylmethyl)quinazolin-4-one (PubChem CID 118053030) has the molecular formula C19H18ClN3O2 and a molecular weight of 355.83 g/mol. Its IUPAC name is 2-amino-7-(3-chlorophenyl)-3-(oxolan-2-ylmethyl)quinazolin-4-one.
| Compound Name | 2-amino-7-(3-chlorophenyl)-3-(oxolan-2-ylmethyl)quinazolin-4-one |
|---|---|
| PubChem CID | 118053030 |
| Molecular Formula | C19H18ClN3O2 |
| Molecular Weight | 355.83 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | 2-amino-7-(3-chlorophenyl)-3-(oxolan-2-ylmethyl)quinazolin-4-one |
| SMILES | Nc1nc2cc(-c3cccc(Cl)c3)ccc2c(=O)n1CC1CCCO1 |
| InChI | InChI=1S/C19H18ClN3O2/c20-14-4-1-3-12(9-14)13-6-7-16-17(10-13)22-19(21)23(18(16)24)11-15-5-2-8-25-15/h1,3-4,6-7,9-10,15H,2,5,8,11H2,(H2,21,22) |
| InChIKey | RZCLGDCXZXTBNF-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.83 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |