C25H32ClN5O4 — CID 118053159
tert-butyl 4-[2-[[5-(2-chloro-7-methylpyrrolo[2,3-d]pyrimidin-4-yl)-3-methyl-2-pyridinyl]oxy]ethoxy]piperidine-1-carboxylate (PubChem CID 118053159) has the molecular formula C25H32ClN5O4 and a molecular weight of 502.02 g/mol. Its IUPAC name is tert-butyl 4-[2-[[5-(2-chloro-7-methylpyrrolo[2,3-d]pyrimidin-4-yl)-3-methyl-2-pyridinyl]oxy]ethoxy]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-[[5-(2-chloro-7-methylpyrrolo[2,3-d]pyrimidin-4-yl)-3-methyl-2-pyridinyl]oxy]ethoxy]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 118053159 |
| Molecular Formula | C25H32ClN5O4 |
| Molecular Weight | 502.02 g/mol |
| Exact Mass | 501.21 |
| IUPAC Name | tert-butyl 4-[2-[[5-(2-chloro-7-methylpyrrolo[2,3-d]pyrimidin-4-yl)-3-methyl-2-pyridinyl]oxy]ethoxy]piperidine-1-carboxylate |
| SMILES | Cc1cc(-c2nc(Cl)nc3c2ccn3C)cnc1OCCOC1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C25H32ClN5O4/c1-16-14-17(20-19-8-9-30(5)21(19)29-23(26)28-20)15-27-22(16)34-13-12-33-18-6-10-31(11-7-18)24(32)35-25(2,3)4/h8-9,14-15,18H,6-7,10-13H2,1-5H3 |
| InChIKey | VXYRJIHMKHAPET-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 91.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.02 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|