C7H6F2N4 — CID 11805405
2-(2-azido-1,1-difluoroethyl)pyridine (PubChem CID 11805405) has the molecular formula C7H6F2N4 and a molecular weight of 184.15 g/mol. Its IUPAC name is 2-(2-azido-1,1-difluoroethyl)pyridine.
| Compound Name | 2-(2-azido-1,1-difluoroethyl)pyridine |
|---|---|
| PubChem CID | 11805405 |
| Molecular Formula | C7H6F2N4 |
| Molecular Weight | 184.15 g/mol |
| Exact Mass | 184.06 |
| IUPAC Name | 2-(2-azido-1,1-difluoroethyl)pyridine |
| SMILES | [N-]=[N+]=NCC(F)(F)c1ccccn1 |
| InChI | InChI=1S/C7H6F2N4/c8-7(9,5-12-13-10)6-3-1-2-4-11-6/h1-4H,5H2 |
| InChIKey | UEQIOIGGEPWPMI-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 61.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.15 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|