About [4-[2-(4-chlorobenzoyl)phenyl]-3-methyl-1,2-oxazol-5-yl] 2-methylbenzoate
[4-[2-(4-chlorobenzoyl)phenyl]-3-methyl-1,2-oxazol-5-yl] 2-methylbenzoate (PubChem CID 118057921) has the molecular formula C25H18ClNO4
and a molecular weight of 431.88 g/mol. Its IUPAC name is [4-[2-(4-chlorobenzoyl)phenyl]-3-methyl-1,2-oxazol-5-yl] 2-methylbenzoate.
Molecular Properties
| Compound Name | [4-[2-(4-chlorobenzoyl)phenyl]-3-methyl-1,2-oxazol-5-yl] 2-methylbenzoate |
| PubChem CID | 118057921 |
| Molecular Formula | C25H18ClNO4 |
| Molecular Weight | 431.88 g/mol |
| Exact Mass | 431.09 |
| IUPAC Name | [4-[2-(4-chlorobenzoyl)phenyl]-3-methyl-1,2-oxazol-5-yl] 2-methylbenzoate |
| SMILES | Cc1ccccc1C(=O)Oc1onc(C)c1-c1ccccc1C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H18ClNO4/c1-15-7-3-4-8-19(15)24(29)30-25-22(16(2)27-31-25)20-9-5-6-10-21(20)23(28)17-11-13-18(26)14-12-17/h3-14H,1-2H3 |
| InChIKey | FARVVXPXSGNAPF-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 69.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 431.88 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [4-[2-(4-chlorobenzoyl)phenyl]-3-methyl-1,2-oxazol-5-yl] 2-methylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[2-(4-chlorobenzoyl)phenyl]-3-methyl-1,2-oxazol-5-yl] 2-methylbenzoate?
The IUPAC name of [4-[2-(4-chlorobenzoyl)phenyl]-3-methyl-1,2-oxazol-5-yl] 2-methylbenzoate (CID 118057921) is [4-[2-(4-chlorobenzoyl)phenyl]-3-methyl-1,2-oxazol-5-yl] 2-methylbenzoate.
What is the SMILES notation for [4-[2-(4-chlorobenzoyl)phenyl]-3-methyl-1,2-oxazol-5-yl] 2-methylbenzoate?
The canonical SMILES for [4-[2-(4-chlorobenzoyl)phenyl]-3-methyl-1,2-oxazol-5-yl] 2-methylbenzoate is Cc1ccccc1C(=O)Oc1onc(C)c1-c1ccccc1C(=O)c1ccc(Cl)cc1.
What is the InChIKey of [4-[2-(4-chlorobenzoyl)phenyl]-3-methyl-1,2-oxazol-5-yl] 2-methylbenzoate?
The InChIKey is FARVVXPXSGNAPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H18ClNO4/c1-15-7-3-4-8-19(15)24(29)30-25-22(16(2)27-31-25)20-9-5-6-10-21(20)23(28)17-11-13-18(26)14-12-17/h3-14H,1-2H3.
What are the key properties of [4-[2-(4-chlorobenzoyl)phenyl]-3-methyl-1,2-oxazol-5-yl] 2-methylbenzoate?
[4-[2-(4-chlorobenzoyl)phenyl]-3-methyl-1,2-oxazol-5-yl] 2-methylbenzoate has a molecular weight of 431.88 g/mol, XLogP of 6.06, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[2-(4-chlorobenzoyl)phenyl]-3-methyl-1,2-oxazol-5-yl] 2-methylbenzoate is sourced from PubChem (CID 118057921), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).