C22H16ClN3O2 — CID 19330668
[2-[3-(3-amino-2-methylphenyl)-1,2,4-oxadiazol-5-yl]phenyl]-(4-chlorophenyl)methanone (PubChem CID 19330668) has the molecular formula C22H16ClN3O2 and a molecular weight of 389.84 g/mol. Its IUPAC name is [2-[3-(3-amino-2-methylphenyl)-1,2,4-oxadiazol-5-yl]phenyl]-(4-chlorophenyl)methanone.
| Compound Name | [2-[3-(3-amino-2-methylphenyl)-1,2,4-oxadiazol-5-yl]phenyl]-(4-chlorophenyl)methanone |
|---|---|
| PubChem CID | 19330668 |
| Molecular Formula | C22H16ClN3O2 |
| Molecular Weight | 389.84 g/mol |
| Exact Mass | 389.09 |
| IUPAC Name | [2-[3-(3-amino-2-methylphenyl)-1,2,4-oxadiazol-5-yl]phenyl]-(4-chlorophenyl)methanone |
| SMILES | Cc1c(N)cccc1-c1noc(-c2ccccc2C(=O)c2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C22H16ClN3O2/c1-13-16(7-4-8-19(13)24)21-25-22(28-26-21)18-6-3-2-5-17(18)20(27)14-9-11-15(23)12-10-14/h2-12H,24H2,1H3 |
| InChIKey | IQKMYKPPXDJIIS-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 82.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.84 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|