C11H14F3NO2 — CID 118062447
4-methyl-1-propylpyridin-1-ium;2,2,2-trifluoroacetate (PubChem CID 118062447) has the molecular formula C11H14F3NO2 and a molecular weight of 249.23 g/mol. Its IUPAC name is 4-methyl-1-propylpyridin-1-ium;2,2,2-trifluoroacetate.
| Compound Name | 4-methyl-1-propylpyridin-1-ium;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 118062447 |
| Molecular Formula | C11H14F3NO2 |
| Molecular Weight | 249.23 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | 4-methyl-1-propylpyridin-1-ium;2,2,2-trifluoroacetate |
| SMILES | CCC[n+]1ccc(C)cc1.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C9H14N.C2HF3O2/c1-3-6-10-7-4-9(2)5-8-10;3-2(4,5)1(6)7/h4-5,7-8H,3,6H2,1-2H3;(H,6,7)/q+1;/p-1 |
| InChIKey | YFTCTWDDXCYQKQ-UHFFFAOYSA-M |
| XLogP | 0.99 |
| TPSA | 44.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.23 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|