C9H14ClN2O+ — CID 126959661
3-(4-methylpyridin-1-ium-1-yl)propanamide;hydrochloride (PubChem CID 126959661) has the molecular formula C9H14ClN2O+ and a molecular weight of 201.68 g/mol. Its IUPAC name is 3-(4-methylpyridin-1-ium-1-yl)propanamide;hydrochloride.
| Compound Name | 3-(4-methylpyridin-1-ium-1-yl)propanamide;hydrochloride |
|---|---|
| PubChem CID | 126959661 |
| Molecular Formula | C9H14ClN2O+ |
| Molecular Weight | 201.68 g/mol |
| Exact Mass | 201.08 |
| IUPAC Name | 3-(4-methylpyridin-1-ium-1-yl)propanamide;hydrochloride |
| SMILES | Cc1cc[n+](CCC(N)=O)cc1.Cl |
| InChI | InChI=1S/C9H12N2O.ClH/c1-8-2-5-11(6-3-8)7-4-9(10)12;/h2-3,5-6H,4,7H2,1H3,(H-,10,12);1H/p+1 |
| InChIKey | IVHLVSKCPFMKPN-UHFFFAOYSA-O |
| XLogP | 0.58 |
| TPSA | 46.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.68 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|