C23H28FN5O5S — CID 118062477
(6S)-4-[4-fluoro-2-(2-hydroxyethoxy)anilino]-N-(3-methylsulfonylpropyl)-6,7,8,9-tetrahydro-5H-pyrimido[4,5-b]indole-6-carboxamide (PubChem CID 118062477) has the molecular formula C23H28FN5O5S and a molecular weight of 505.57 g/mol. Its IUPAC name is (6S)-4-[4-fluoro-2-(2-hydroxyethoxy)anilino]-N-(3-methylsulfonylpropyl)-6,7,8,9-tetrahydro-5H-pyrimido[4,5-b]indole-6-carboxamide.
| Compound Name | (6S)-4-[4-fluoro-2-(2-hydroxyethoxy)anilino]-N-(3-methylsulfonylpropyl)-6,7,8,9-tetrahydro-5H-pyrimido[4,5-b]indole-6-carboxamide |
|---|---|
| PubChem CID | 118062477 |
| Molecular Formula | C23H28FN5O5S |
| Molecular Weight | 505.57 g/mol |
| Exact Mass | 505.18 |
| IUPAC Name | (6S)-4-[4-fluoro-2-(2-hydroxyethoxy)anilino]-N-(3-methylsulfonylpropyl)-6,7,8,9-tetrahydro-5H-pyrimido[4,5-b]indole-6-carboxamide |
| SMILES | CS(=O)(=O)CCCNC(=O)[C@H]1CCc2[nH]c3ncnc(Nc4ccc(F)cc4OCCO)c3c2C1 |
| InChI | InChI=1S/C23H28FN5O5S/c1-35(32,33)10-2-7-25-23(31)14-3-5-17-16(11-14)20-21(28-17)26-13-27-22(20)29-18-6-4-15(24)12-19(18)34-9-8-30/h4,6,12-14,30H,2-3,5,7-11H2,1H3,(H,25,31)(H2,26,27,28,29)/t14-/m0/s1 |
| InChIKey | RCBUNNIXIKJAOF-AWEZNQCLSA-N |
| XLogP | 1.87 |
| TPSA | 146.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.57 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|