C25H33N5O4S — CID 118062484
(6S)-4-[2-(2-methylpropoxy)anilino]-N-(3-methylsulfonylpropyl)-6,7,8,9-tetrahydro-5H-pyrimido[4,5-b]indole-6-carboxamide (PubChem CID 118062484) has the molecular formula C25H33N5O4S and a molecular weight of 499.64 g/mol. Its IUPAC name is (6S)-4-[2-(2-methylpropoxy)anilino]-N-(3-methylsulfonylpropyl)-6,7,8,9-tetrahydro-5H-pyrimido[4,5-b]indole-6-carboxamide.
| Compound Name | (6S)-4-[2-(2-methylpropoxy)anilino]-N-(3-methylsulfonylpropyl)-6,7,8,9-tetrahydro-5H-pyrimido[4,5-b]indole-6-carboxamide |
|---|---|
| PubChem CID | 118062484 |
| Molecular Formula | C25H33N5O4S |
| Molecular Weight | 499.64 g/mol |
| Exact Mass | 499.23 |
| IUPAC Name | (6S)-4-[2-(2-methylpropoxy)anilino]-N-(3-methylsulfonylpropyl)-6,7,8,9-tetrahydro-5H-pyrimido[4,5-b]indole-6-carboxamide |
| SMILES | CC(C)COc1ccccc1Nc1ncnc2[nH]c3c(c12)C[C@@H](C(=O)NCCCS(C)(=O)=O)CC3 |
| InChI | InChI=1S/C25H33N5O4S/c1-16(2)14-34-21-8-5-4-7-20(21)30-24-22-18-13-17(25(31)26-11-6-12-35(3,32)33)9-10-19(18)29-23(22)27-15-28-24/h4-5,7-8,15-17H,6,9-14H2,1-3H3,(H,26,31)(H2,27,28,29,30)/t17-/m0/s1 |
| InChIKey | LKVDXALJCKIFOS-KRWDZBQOSA-N |
| XLogP | 3.39 |
| TPSA | 126.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.64 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|