C24H32N6O4S — CID 118062468
(6S)-4-[5-(dimethylamino)-2-methoxyanilino]-N-(3-methylsulfonylpropyl)-6,7,8,9-tetrahydro-5H-pyrimido[4,5-b]indole-6-carboxamide (PubChem CID 118062468) has the molecular formula C24H32N6O4S and a molecular weight of 500.63 g/mol. Its IUPAC name is (6S)-4-[5-(dimethylamino)-2-methoxyanilino]-N-(3-methylsulfonylpropyl)-6,7,8,9-tetrahydro-5H-pyrimido[4,5-b]indole-6-carboxamide.
| Compound Name | (6S)-4-[5-(dimethylamino)-2-methoxyanilino]-N-(3-methylsulfonylpropyl)-6,7,8,9-tetrahydro-5H-pyrimido[4,5-b]indole-6-carboxamide |
|---|---|
| PubChem CID | 118062468 |
| Molecular Formula | C24H32N6O4S |
| Molecular Weight | 500.63 g/mol |
| Exact Mass | 500.22 |
| IUPAC Name | (6S)-4-[5-(dimethylamino)-2-methoxyanilino]-N-(3-methylsulfonylpropyl)-6,7,8,9-tetrahydro-5H-pyrimido[4,5-b]indole-6-carboxamide |
| SMILES | COc1ccc(N(C)C)cc1Nc1ncnc2[nH]c3c(c12)C[C@@H](C(=O)NCCCS(C)(=O)=O)CC3 |
| InChI | InChI=1S/C24H32N6O4S/c1-30(2)16-7-9-20(34-3)19(13-16)29-23-21-17-12-15(24(31)25-10-5-11-35(4,32)33)6-8-18(17)28-22(21)26-14-27-23/h7,9,13-15H,5-6,8,10-12H2,1-4H3,(H,25,31)(H2,26,27,28,29)/t15-/m0/s1 |
| InChIKey | CUHQCTSJXUMHFE-HNNXBMFYSA-N |
| XLogP | 2.43 |
| TPSA | 129.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.63 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|