C24H28N6O4S2 — CID 118062155
(6S)-4-[(5-methoxy-2-methyl-1,3-benzothiazol-6-yl)amino]-N-(3-methylsulfonylpropyl)-6,7,8,9-tetrahydro-5H-pyrimido[4,5-b]indole-6-carboxamide (PubChem CID 118062155) has the molecular formula C24H28N6O4S2 and a molecular weight of 528.66 g/mol. Its IUPAC name is (6S)-4-[(5-methoxy-2-methyl-1,3-benzothiazol-6-yl)amino]-N-(3-methylsulfonylpropyl)-6,7,8,9-tetrahydro-5H-pyrimido[4,5-b]indole-6-carboxamide.
| Compound Name | (6S)-4-[(5-methoxy-2-methyl-1,3-benzothiazol-6-yl)amino]-N-(3-methylsulfonylpropyl)-6,7,8,9-tetrahydro-5H-pyrimido[4,5-b]indole-6-carboxamide |
|---|---|
| PubChem CID | 118062155 |
| Molecular Formula | C24H28N6O4S2 |
| Molecular Weight | 528.66 g/mol |
| Exact Mass | 528.16 |
| IUPAC Name | (6S)-4-[(5-methoxy-2-methyl-1,3-benzothiazol-6-yl)amino]-N-(3-methylsulfonylpropyl)-6,7,8,9-tetrahydro-5H-pyrimido[4,5-b]indole-6-carboxamide |
| SMILES | COc1cc2nc(C)sc2cc1Nc1ncnc2[nH]c3c(c12)C[C@@H](C(=O)NCCCS(C)(=O)=O)CC3 |
| InChI | InChI=1S/C24H28N6O4S2/c1-13-28-18-10-19(34-2)17(11-20(18)35-13)30-23-21-15-9-14(24(31)25-7-4-8-36(3,32)33)5-6-16(15)29-22(21)26-12-27-23/h10-12,14H,4-9H2,1-3H3,(H,25,31)(H2,26,27,29,30)/t14-/m0/s1 |
| InChIKey | BSZGQPGXSCWDTL-AWEZNQCLSA-N |
| XLogP | 3.28 |
| TPSA | 138.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.66 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|