C35H34ClN5O2 — CID 118062709
benzyl-bis[[4-(phenylcarbamoylamino)phenyl]methyl]azanium chloride (PubChem CID 118062709) has the molecular formula C35H34ClN5O2 and a molecular weight of 592.14 g/mol. Its IUPAC name is benzyl-bis[[4-(phenylcarbamoylamino)phenyl]methyl]azanium chloride.
| Compound Name | benzyl-bis[[4-(phenylcarbamoylamino)phenyl]methyl]azanium chloride |
|---|---|
| PubChem CID | 118062709 |
| Molecular Formula | C35H34ClN5O2 |
| Molecular Weight | 592.14 g/mol |
| Exact Mass | 591.24 |
| IUPAC Name | benzyl-bis[[4-(phenylcarbamoylamino)phenyl]methyl]azanium chloride |
| SMILES | O=C(Nc1ccccc1)Nc1ccc(C[NH+](Cc2ccccc2)Cc2ccc(NC(=O)Nc3ccccc3)cc2)cc1.[Cl-] |
| InChI | InChI=1S/C35H33N5O2.ClH/c41-34(36-30-12-6-2-7-13-30)38-32-20-16-28(17-21-32)25-40(24-27-10-4-1-5-11-27)26-29-18-22-33(23-19-29)39-35(42)37-31-14-8-3-9-15-31;/h1-23H,24-26H2,(H2,36,38,41)(H2,37,39,42);1H |
| InChIKey | NMONQOYTEHSOOJ-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 86.70 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.14 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 2 |