C18H12ClF4N5O2 — CID 118064134
2-[(5-chloro-2-pyridinyl)amino]-N-[6-fluoro-4-(2,2,2-trifluoroethoxy)-3-pyridinyl]pyridine-4-carboxamide (PubChem CID 118064134) has the molecular formula C18H12ClF4N5O2 and a molecular weight of 441.77 g/mol. Its IUPAC name is 2-[(5-chloro-2-pyridinyl)amino]-N-[6-fluoro-4-(2,2,2-trifluoroethoxy)-3-pyridinyl]pyridine-4-carboxamide.
| Compound Name | 2-[(5-chloro-2-pyridinyl)amino]-N-[6-fluoro-4-(2,2,2-trifluoroethoxy)-3-pyridinyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 118064134 |
| Molecular Formula | C18H12ClF4N5O2 |
| Molecular Weight | 441.77 g/mol |
| Exact Mass | 441.06 |
| IUPAC Name | 2-[(5-chloro-2-pyridinyl)amino]-N-[6-fluoro-4-(2,2,2-trifluoroethoxy)-3-pyridinyl]pyridine-4-carboxamide |
| SMILES | O=C(Nc1cnc(F)cc1OCC(F)(F)F)c1ccnc(Nc2ccc(Cl)cn2)c1 |
| InChI | InChI=1S/C18H12ClF4N5O2/c19-11-1-2-15(26-7-11)28-16-5-10(3-4-24-16)17(29)27-12-8-25-14(20)6-13(12)30-9-18(21,22)23/h1-8H,9H2,(H,27,29)(H,24,26,28) |
| InChIKey | HWWRUYWNINJRAU-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 89.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.77 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|