C16H15F4N5O2 — CID 134556481
2-(cyclobutylamino)-N-[6-fluoro-4-(2,2,2-trifluoroethoxy)-3-pyridinyl]pyrimidine-4-carboxamide (PubChem CID 134556481) has the molecular formula C16H15F4N5O2 and a molecular weight of 385.32 g/mol. Its IUPAC name is 2-(cyclobutylamino)-N-[6-fluoro-4-(2,2,2-trifluoroethoxy)-3-pyridinyl]pyrimidine-4-carboxamide.
| Compound Name | 2-(cyclobutylamino)-N-[6-fluoro-4-(2,2,2-trifluoroethoxy)-3-pyridinyl]pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 134556481 |
| Molecular Formula | C16H15F4N5O2 |
| Molecular Weight | 385.32 g/mol |
| Exact Mass | 385.12 |
| IUPAC Name | 2-(cyclobutylamino)-N-[6-fluoro-4-(2,2,2-trifluoroethoxy)-3-pyridinyl]pyrimidine-4-carboxamide |
| SMILES | O=C(Nc1cnc(F)cc1OCC(F)(F)F)c1ccnc(NC2CCC2)n1 |
| InChI | InChI=1S/C16H15F4N5O2/c17-13-6-12(27-8-16(18,19)20)11(7-22-13)24-14(26)10-4-5-21-15(25-10)23-9-2-1-3-9/h4-7,9H,1-3,8H2,(H,24,26)(H,21,23,25) |
| InChIKey | VAOOBFAJBZXGEB-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 89.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.32 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|