C13H12O4 — CID 11806522
bis(prop-2-ynyl) 3,3-dimethylcyclopropene-1,2-dicarboxylate (PubChem CID 11806522) has the molecular formula C13H12O4 and a molecular weight of 232.23 g/mol. Its IUPAC name is bis(prop-2-ynyl) 3,3-dimethylcyclopropene-1,2-dicarboxylate.
| Compound Name | bis(prop-2-ynyl) 3,3-dimethylcyclopropene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 11806522 |
| Molecular Formula | C13H12O4 |
| Molecular Weight | 232.23 g/mol |
| Exact Mass | 232.07 |
| IUPAC Name | bis(prop-2-ynyl) 3,3-dimethylcyclopropene-1,2-dicarboxylate |
| SMILES | C#CCOC(=O)C1=C(C(=O)OCC#C)C1(C)C |
| InChI | InChI=1S/C13H12O4/c1-5-7-16-11(14)9-10(13(9,3)4)12(15)17-8-6-2/h1-2H,7-8H2,3-4H3 |
| InChIKey | MKZATWXCCLDTPX-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.23 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|