C22H22N6O3 — CID 118067194
4-N-methyl-1-N-[4-(3-nitrophenoxy)-7H-pyrrolo[2,3-d]pyrimidin-2-yl]-4-N-propylbenzene-1,4-diamine (PubChem CID 118067194) has the molecular formula C22H22N6O3 and a molecular weight of 418.46 g/mol. Its IUPAC name is 4-N-methyl-1-N-[4-(3-nitrophenoxy)-7H-pyrrolo[2,3-d]pyrimidin-2-yl]-4-N-propylbenzene-1,4-diamine.
| Compound Name | 4-N-methyl-1-N-[4-(3-nitrophenoxy)-7H-pyrrolo[2,3-d]pyrimidin-2-yl]-4-N-propylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 118067194 |
| Molecular Formula | C22H22N6O3 |
| Molecular Weight | 418.46 g/mol |
| Exact Mass | 418.18 |
| IUPAC Name | 4-N-methyl-1-N-[4-(3-nitrophenoxy)-7H-pyrrolo[2,3-d]pyrimidin-2-yl]-4-N-propylbenzene-1,4-diamine |
| SMILES | CCCN(C)c1ccc(Nc2nc(Oc3cccc([N+](=O)[O-])c3)c3cc[nH]c3n2)cc1 |
| InChI | InChI=1S/C22H22N6O3/c1-3-13-27(2)16-9-7-15(8-10-16)24-22-25-20-19(11-12-23-20)21(26-22)31-18-6-4-5-17(14-18)28(29)30/h4-12,14H,3,13H2,1-2H3,(H2,23,24,25,26) |
| InChIKey | FRZAPPUMAOQLKT-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 109.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.46 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|