C15H7ClF3N3O3S — CID 118069617
N-[3-[(6-chloro-[1,3]thiazolo[5,4-b]pyridin-2-yl)methoxy]-2,6-difluorobenzoyl]carbamoyl fluoride (PubChem CID 118069617) has the molecular formula C15H7ClF3N3O3S and a molecular weight of 401.75 g/mol. Its IUPAC name is N-[3-[(6-chloro-[1,3]thiazolo[5,4-b]pyridin-2-yl)methoxy]-2,6-difluorobenzoyl]carbamoyl fluoride.
| Compound Name | N-[3-[(6-chloro-[1,3]thiazolo[5,4-b]pyridin-2-yl)methoxy]-2,6-difluorobenzoyl]carbamoyl fluoride |
|---|---|
| PubChem CID | 118069617 |
| Molecular Formula | C15H7ClF3N3O3S |
| Molecular Weight | 401.75 g/mol |
| Exact Mass | 400.98 |
| IUPAC Name | N-[3-[(6-chloro-[1,3]thiazolo[5,4-b]pyridin-2-yl)methoxy]-2,6-difluorobenzoyl]carbamoyl fluoride |
| SMILES | O=C(F)NC(=O)c1c(F)ccc(OCc2nc3cc(Cl)cnc3s2)c1F |
| InChI | InChI=1S/C15H7ClF3N3O3S/c16-6-3-8-14(20-4-6)26-10(21-8)5-25-9-2-1-7(17)11(12(9)18)13(23)22-15(19)24/h1-4H,5H2,(H,22,23,24) |
| InChIKey | NRNRFSOQHUBIHA-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.75 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|