C17H26O3 — CID 118070321
3-methylbut-2-enyl 2-(4-oxo-5-pentylcyclopenten-1-yl)acetate (PubChem CID 118070321) has the molecular formula C17H26O3 and a molecular weight of 278.39 g/mol. Its IUPAC name is 3-methylbut-2-enyl 2-(4-oxo-5-pentylcyclopenten-1-yl)acetate.
| Compound Name | 3-methylbut-2-enyl 2-(4-oxo-5-pentylcyclopenten-1-yl)acetate |
|---|---|
| PubChem CID | 118070321 |
| Molecular Formula | C17H26O3 |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | 3-methylbut-2-enyl 2-(4-oxo-5-pentylcyclopenten-1-yl)acetate |
| SMILES | CCCCCC1C(=O)CC=C1CC(=O)OCC=C(C)C |
| InChI | InChI=1S/C17H26O3/c1-4-5-6-7-15-14(8-9-16(15)18)12-17(19)20-11-10-13(2)3/h8,10,15H,4-7,9,11-12H2,1-3H3 |
| InChIKey | OCMGTDSGYWLAPC-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|