C10H16O16S2 — CID 118085870
3,4-dihydroxy-6-(3-hydroxy-1-oxo-4-sulfooxybutan-2-yl)oxy-5-sulfooxyoxane-2-carboxylic acid (PubChem CID 118085870) has the molecular formula C10H16O16S2 and a molecular weight of 456.36 g/mol. Its IUPAC name is 3,4-dihydroxy-6-(3-hydroxy-1-oxo-4-sulfooxybutan-2-yl)oxy-5-sulfooxyoxane-2-carboxylic acid.
| Compound Name | 3,4-dihydroxy-6-(3-hydroxy-1-oxo-4-sulfooxybutan-2-yl)oxy-5-sulfooxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 118085870 |
| Molecular Formula | C10H16O16S2 |
| Molecular Weight | 456.36 g/mol |
| Exact Mass | 455.99 |
| IUPAC Name | 3,4-dihydroxy-6-(3-hydroxy-1-oxo-4-sulfooxybutan-2-yl)oxy-5-sulfooxyoxane-2-carboxylic acid |
| SMILES | O=CC(OC1OC(C(=O)O)C(O)C(O)C1OS(=O)(=O)O)C(O)COS(=O)(=O)O |
| InChI | InChI=1S/C10H16O16S2/c11-1-4(3(12)2-23-27(17,18)19)24-10-8(26-28(20,21)22)6(14)5(13)7(25-10)9(15)16/h1,3-8,10,12-14H,2H2,(H,15,16)(H,17,18,19)(H,20,21,22) |
| InChIKey | CJOPKPSXUPSNOR-UHFFFAOYSA-N |
| XLogP | -4.53 |
| TPSA | 260.72 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.36 |
| LogP ≤ 5 | -4.53 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|