C16H26O5 — CID 11808660
methyl (2S)-2-[(2R,2aR,4aS,7R,8aR)-2-(hydroxymethyl)-2a,4a-dimethyl-2,4,5,6,7,8-hexahydrooxeto[2,3-i][2]benzofuran-7-yl]propanoate (PubChem CID 11808660) has the molecular formula C16H26O5 and a molecular weight of 298.38 g/mol. Its IUPAC name is methyl (2S)-2-[(2R,2aR,4aS,7R,8aR)-2-(hydroxymethyl)-2a,4a-dimethyl-2,4,5,6,7,8-hexahydrooxeto[2,3-i][2]benzofuran-7-yl]propanoate.
| Compound Name | methyl (2S)-2-[(2R,2aR,4aS,7R,8aR)-2-(hydroxymethyl)-2a,4a-dimethyl-2,4,5,6,7,8-hexahydrooxeto[2,3-i][2]benzofuran-7-yl]propanoate |
|---|---|
| PubChem CID | 11808660 |
| Molecular Formula | C16H26O5 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.18 |
| IUPAC Name | methyl (2S)-2-[(2R,2aR,4aS,7R,8aR)-2-(hydroxymethyl)-2a,4a-dimethyl-2,4,5,6,7,8-hexahydrooxeto[2,3-i][2]benzofuran-7-yl]propanoate |
| SMILES | COC(=O)[C@@H](C)[C@@H]1CC[C@@]2(C)CO[C@]3(C)[C@@H](CO)O[C@]23C1 |
| InChI | InChI=1S/C16H26O5/c1-10(13(18)19-4)11-5-6-14(2)9-20-15(3)12(8-17)21-16(14,15)7-11/h10-12,17H,5-9H2,1-4H3/t10-,11+,12+,14-,15+,16+/m0/s1 |
| InChIKey | TUSZRJKXQBLMCF-FDXKKBNASA-N |
| XLogP | 1.52 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |