C15H32N2O2Si — CID 11808760
tert-butyl 3-propan-2-yl-6-trimethylsilyl-1,3-diazinane-1-carboxylate (PubChem CID 11808760) has the molecular formula C15H32N2O2Si and a molecular weight of 300.52 g/mol. Its IUPAC name is tert-butyl 3-propan-2-yl-6-trimethylsilyl-1,3-diazinane-1-carboxylate.
| Compound Name | tert-butyl 3-propan-2-yl-6-trimethylsilyl-1,3-diazinane-1-carboxylate |
|---|---|
| PubChem CID | 11808760 |
| Molecular Formula | C15H32N2O2Si |
| Molecular Weight | 300.52 g/mol |
| Exact Mass | 300.22 |
| IUPAC Name | tert-butyl 3-propan-2-yl-6-trimethylsilyl-1,3-diazinane-1-carboxylate |
| SMILES | CC(C)N1CCC([Si](C)(C)C)N(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C15H32N2O2Si/c1-12(2)16-10-9-13(20(6,7)8)17(11-16)14(18)19-15(3,4)5/h12-13H,9-11H2,1-8H3 |
| InChIKey | XVPFNPLHNXYCHA-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.52 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|