C16H18ClNO3 — CID 11808981
benzyl (1R,5S,7S)-7-(2-chloroethyl)-6-oxo-2-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 11808981) has the molecular formula C16H18ClNO3 and a molecular weight of 307.78 g/mol. Its IUPAC name is benzyl (1R,5S,7S)-7-(2-chloroethyl)-6-oxo-2-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | benzyl (1R,5S,7S)-7-(2-chloroethyl)-6-oxo-2-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 11808981 |
| Molecular Formula | C16H18ClNO3 |
| Molecular Weight | 307.78 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | benzyl (1R,5S,7S)-7-(2-chloroethyl)-6-oxo-2-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | O=C1[C@@H](CCCl)[C@H]2[C@@H]1CCN2C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C16H18ClNO3/c17-8-6-12-14-13(15(12)19)7-9-18(14)16(20)21-10-11-4-2-1-3-5-11/h1-5,12-14H,6-10H2/t12-,13-,14-/m0/s1 |
| InChIKey | MKMOYBYSIKWTTM-IHRRRGAJSA-N |
| XLogP | 2.84 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.78 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|