C15H15Cl2NO3 — CID 11012866
benzyl (3aS,6aS)-6,6-dichloro-5-oxo-3,3a,4,6a-tetrahydro-2H-cyclopenta[b]pyrrole-1-carboxylate (PubChem CID 11012866) has the molecular formula C15H15Cl2NO3 and a molecular weight of 328.19 g/mol. Its IUPAC name is benzyl (3aS,6aS)-6,6-dichloro-5-oxo-3,3a,4,6a-tetrahydro-2H-cyclopenta[b]pyrrole-1-carboxylate.
| Compound Name | benzyl (3aS,6aS)-6,6-dichloro-5-oxo-3,3a,4,6a-tetrahydro-2H-cyclopenta[b]pyrrole-1-carboxylate |
|---|---|
| PubChem CID | 11012866 |
| Molecular Formula | C15H15Cl2NO3 |
| Molecular Weight | 328.19 g/mol |
| Exact Mass | 327.04 |
| IUPAC Name | benzyl (3aS,6aS)-6,6-dichloro-5-oxo-3,3a,4,6a-tetrahydro-2H-cyclopenta[b]pyrrole-1-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1CC[C@H]2CC(=O)C(Cl)(Cl)[C@H]21 |
| InChI | InChI=1S/C15H15Cl2NO3/c16-15(17)12(19)8-11-6-7-18(13(11)15)14(20)21-9-10-4-2-1-3-5-10/h1-5,11,13H,6-9H2/t11-,13-/m0/s1 |
| InChIKey | LJWJGEOBXRQLAZ-AAEUAGOBSA-N |
| XLogP | 3.16 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.19 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|