C19H21NO3 — CID 11809099
ethyl (3R,5R)-2-benzyl-3-phenyl-1,2-oxazolidine-5-carboxylate (PubChem CID 11809099) has the molecular formula C19H21NO3 and a molecular weight of 311.38 g/mol. Its IUPAC name is ethyl (3R,5R)-2-benzyl-3-phenyl-1,2-oxazolidine-5-carboxylate.
| Compound Name | ethyl (3R,5R)-2-benzyl-3-phenyl-1,2-oxazolidine-5-carboxylate |
|---|---|
| PubChem CID | 11809099 |
| Molecular Formula | C19H21NO3 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.15 |
| IUPAC Name | ethyl (3R,5R)-2-benzyl-3-phenyl-1,2-oxazolidine-5-carboxylate |
| SMILES | CCOC(=O)[C@H]1C[C@H](c2ccccc2)N(Cc2ccccc2)O1 |
| InChI | InChI=1S/C19H21NO3/c1-2-22-19(21)18-13-17(16-11-7-4-8-12-16)20(23-18)14-15-9-5-3-6-10-15/h3-12,17-18H,2,13-14H2,1H3/t17-,18-/m1/s1 |
| InChIKey | XTVHUACRTUOKGK-QZTJIDSGSA-N |
| XLogP | 3.50 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |