C24H26F3NO — CID 118091125
2-cyclopentyl-N-[3-(cyclopropylmethyl)phenyl]-2-[4-(trifluoromethyl)phenyl]acetamide (PubChem CID 118091125) has the molecular formula C24H26F3NO and a molecular weight of 401.47 g/mol. Its IUPAC name is 2-cyclopentyl-N-[3-(cyclopropylmethyl)phenyl]-2-[4-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-cyclopentyl-N-[3-(cyclopropylmethyl)phenyl]-2-[4-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 118091125 |
| Molecular Formula | C24H26F3NO |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.20 |
| IUPAC Name | 2-cyclopentyl-N-[3-(cyclopropylmethyl)phenyl]-2-[4-(trifluoromethyl)phenyl]acetamide |
| SMILES | O=C(Nc1cccc(CC2CC2)c1)C(c1ccc(C(F)(F)F)cc1)C1CCCC1 |
| InChI | InChI=1S/C24H26F3NO/c25-24(26,27)20-12-10-19(11-13-20)22(18-5-1-2-6-18)23(29)28-21-7-3-4-17(15-21)14-16-8-9-16/h3-4,7,10-13,15-16,18,22H,1-2,5-6,8-9,14H2,(H,28,29) |
| InChIKey | CQLDRCNWEVHDFC-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |