C24H26ClNO3 — CID 174698422
[3-[[2-(4-chlorophenyl)-2-cyclopentylacetyl]amino]phenyl]methyl cyclopropanecarboxylate (PubChem CID 174698422) has the molecular formula C24H26ClNO3 and a molecular weight of 411.93 g/mol. Its IUPAC name is [3-[[2-(4-chlorophenyl)-2-cyclopentylacetyl]amino]phenyl]methyl cyclopropanecarboxylate.
| Compound Name | [3-[[2-(4-chlorophenyl)-2-cyclopentylacetyl]amino]phenyl]methyl cyclopropanecarboxylate |
|---|---|
| PubChem CID | 174698422 |
| Molecular Formula | C24H26ClNO3 |
| Molecular Weight | 411.93 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | [3-[[2-(4-chlorophenyl)-2-cyclopentylacetyl]amino]phenyl]methyl cyclopropanecarboxylate |
| SMILES | O=C(OCc1cccc(NC(=O)C(c2ccc(Cl)cc2)C2CCCC2)c1)C1CC1 |
| InChI | InChI=1S/C24H26ClNO3/c25-20-12-10-18(11-13-20)22(17-5-1-2-6-17)23(27)26-21-7-3-4-16(14-21)15-29-24(28)19-8-9-19/h3-4,7,10-14,17,19,22H,1-2,5-6,8-9,15H2,(H,26,27) |
| InChIKey | KQTIHALDHZPXSA-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.93 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |