C24H29NO — CID 118091164
(2S)-2-cyclopentyl-N-[3-(cyclopropylmethyl)phenyl]-2-(4-methylphenyl)acetamide (PubChem CID 118091164) has the molecular formula C24H29NO and a molecular weight of 347.50 g/mol. Its IUPAC name is (2S)-2-cyclopentyl-N-[3-(cyclopropylmethyl)phenyl]-2-(4-methylphenyl)acetamide.
| Compound Name | (2S)-2-cyclopentyl-N-[3-(cyclopropylmethyl)phenyl]-2-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 118091164 |
| Molecular Formula | C24H29NO |
| Molecular Weight | 347.50 g/mol |
| Exact Mass | 347.22 |
| IUPAC Name | (2S)-2-cyclopentyl-N-[3-(cyclopropylmethyl)phenyl]-2-(4-methylphenyl)acetamide |
| SMILES | Cc1ccc([C@@H](C(=O)Nc2cccc(CC3CC3)c2)C2CCCC2)cc1 |
| InChI | InChI=1S/C24H29NO/c1-17-9-13-21(14-10-17)23(20-6-2-3-7-20)24(26)25-22-8-4-5-19(16-22)15-18-11-12-18/h4-5,8-10,13-14,16,18,20,23H,2-3,6-7,11-12,15H2,1H3,(H,25,26)/t23-/m0/s1 |
| InChIKey | GBSFHPVDAOCIFS-QHCPKHFHSA-N |
| XLogP | 5.86 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.50 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |