C11H12ClN5O3 — CID 118096554
(4-chloro-3-nitrophenyl)-[(3,5-dimethyl-1,2,4-triazol-4-yl)amino]methanol (PubChem CID 118096554) has the molecular formula C11H12ClN5O3 and a molecular weight of 297.70 g/mol. Its IUPAC name is (4-chloro-3-nitrophenyl)-[(3,5-dimethyl-1,2,4-triazol-4-yl)amino]methanol.
| Compound Name | (4-chloro-3-nitrophenyl)-[(3,5-dimethyl-1,2,4-triazol-4-yl)amino]methanol |
|---|---|
| PubChem CID | 118096554 |
| Molecular Formula | C11H12ClN5O3 |
| Molecular Weight | 297.70 g/mol |
| Exact Mass | 297.06 |
| IUPAC Name | (4-chloro-3-nitrophenyl)-[(3,5-dimethyl-1,2,4-triazol-4-yl)amino]methanol |
| SMILES | Cc1nnc(C)n1NC(O)c1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C11H12ClN5O3/c1-6-13-14-7(2)16(6)15-11(18)8-3-4-9(12)10(5-8)17(19)20/h3-5,11,15,18H,1-2H3 |
| InChIKey | BEPBBOYWMXMYMJ-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 106.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.70 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|