C27H41N7O5 — CID 118099547
[(1S,10R)-2-butanoyl-11-methyl-3-oxa-11-azatetracyclo[6.4.1.11,10.04,13]tetradeca-4,6,8(13)-trien-5-yl] N-[2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]ethyl]-N-methylcarbamate (PubChem CID 118099547) has the molecular formula C27H41N7O5 and a molecular weight of 543.67 g/mol. Its IUPAC name is [(1S,10R)-2-butanoyl-11-methyl-3-oxa-11-azatetracyclo[6.4.1.11,10.04,13]tetradeca-4,6,8(13)-trien-5-yl] N-[2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]ethyl]-N-methylcarbamate.
| Compound Name | [(1S,10R)-2-butanoyl-11-methyl-3-oxa-11-azatetracyclo[6.4.1.11,10.04,13]tetradeca-4,6,8(13)-trien-5-yl] N-[2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]ethyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 118099547 |
| Molecular Formula | C27H41N7O5 |
| Molecular Weight | 543.67 g/mol |
| Exact Mass | 543.32 |
| IUPAC Name | [(1S,10R)-2-butanoyl-11-methyl-3-oxa-11-azatetracyclo[6.4.1.11,10.04,13]tetradeca-4,6,8(13)-trien-5-yl] N-[2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]ethyl]-N-methylcarbamate |
| SMILES | CCCC(=O)C1Oc2c(OC(=O)N(C)CCNC(=O)[C@@H](N)CCCN=C(N)N)ccc3c2[C@]12C[C@@H](C3)N(C)C2 |
| InChI | InChI=1S/C27H41N7O5/c1-4-6-19(35)23-27-14-17(34(3)15-27)13-16-8-9-20(22(39-23)21(16)27)38-26(37)33(2)12-11-31-24(36)18(28)7-5-10-32-25(29)30/h8-9,17-18,23H,4-7,10-15,28H2,1-3H3,(H,31,36)(H4,29,30,32)/t17-,18+,23?,27-/m1/s1 |
| InChIKey | BWVGXRINNDWZQP-DVENBPSASA-N |
| XLogP | 0.24 |
| TPSA | 178.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.67 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|