C29H41N5O6 — CID 71711501
[(4R,4aR,7aR,12bS)-3-methyl-7-oxo-1,2,4,4a,5,6,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] N-[2-[[(2R)-2-acetamido-6-aminohexanoyl]amino]ethyl]-N-methylcarbamate (PubChem CID 71711501) has the molecular formula C29H41N5O6 and a molecular weight of 555.68 g/mol. Its IUPAC name is [(4R,4aR,7aR,12bS)-3-methyl-7-oxo-1,2,4,4a,5,6,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] N-[2-[[(2R)-2-acetamido-6-aminohexanoyl]amino]ethyl]-N-methylcarbamate.
| Compound Name | [(4R,4aR,7aR,12bS)-3-methyl-7-oxo-1,2,4,4a,5,6,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] N-[2-[[(2R)-2-acetamido-6-aminohexanoyl]amino]ethyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 71711501 |
| Molecular Formula | C29H41N5O6 |
| Molecular Weight | 555.68 g/mol |
| Exact Mass | 555.31 |
| IUPAC Name | [(4R,4aR,7aR,12bS)-3-methyl-7-oxo-1,2,4,4a,5,6,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] N-[2-[[(2R)-2-acetamido-6-aminohexanoyl]amino]ethyl]-N-methylcarbamate |
| SMILES | CC(=O)N[C@H](CCCCN)C(=O)NCCN(C)C(=O)Oc1ccc2c3c1O[C@H]1C(=O)CC[C@H]4[C@@H](C2)N(C)CC[C@]314 |
| InChI | InChI=1S/C29H41N5O6/c1-17(35)32-20(6-4-5-12-30)27(37)31-13-15-34(3)28(38)39-23-10-7-18-16-21-19-8-9-22(36)26-29(19,11-14-33(21)2)24(18)25(23)40-26/h7,10,19-21,26H,4-6,8-9,11-16,30H2,1-3H3,(H,31,37)(H,32,35)/t19-,20+,21+,26-,29-/m0/s1 |
| InChIKey | FOFQSVCRVBBWJG-GESOKAOESA-N |
| XLogP | 1.11 |
| TPSA | 143.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.68 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|