C27H39N5O5 — CID 46199491
[(4R,4aR,7aR,12bS)-3-methyl-7-oxo-1,2,4,4a,5,6,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] N-[2-[[(2S)-2,6-diaminohexanoyl]amino]ethyl]-N-methylcarbamate (PubChem CID 46199491) has the molecular formula C27H39N5O5 and a molecular weight of 513.64 g/mol. Its IUPAC name is [(4R,4aR,7aR,12bS)-3-methyl-7-oxo-1,2,4,4a,5,6,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] N-[2-[[(2S)-2,6-diaminohexanoyl]amino]ethyl]-N-methylcarbamate.
| Compound Name | [(4R,4aR,7aR,12bS)-3-methyl-7-oxo-1,2,4,4a,5,6,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] N-[2-[[(2S)-2,6-diaminohexanoyl]amino]ethyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 46199491 |
| Molecular Formula | C27H39N5O5 |
| Molecular Weight | 513.64 g/mol |
| Exact Mass | 513.30 |
| IUPAC Name | [(4R,4aR,7aR,12bS)-3-methyl-7-oxo-1,2,4,4a,5,6,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] N-[2-[[(2S)-2,6-diaminohexanoyl]amino]ethyl]-N-methylcarbamate |
| SMILES | CN(CCNC(=O)[C@@H](N)CCCCN)C(=O)Oc1ccc2c3c1O[C@H]1C(=O)CC[C@H]4[C@@H](C2)N(C)CC[C@]314 |
| InChI | InChI=1S/C27H39N5O5/c1-31-13-10-27-17-7-8-20(33)24(27)37-23-21(9-6-16(22(23)27)15-19(17)31)36-26(35)32(2)14-12-30-25(34)18(29)5-3-4-11-28/h6,9,17-19,24H,3-5,7-8,10-15,28-29H2,1-2H3,(H,30,34)/t17-,18-,19+,24-,27-/m0/s1 |
| InChIKey | ZCDIIPHVXNZLEK-MURMZZOKSA-N |
| XLogP | 0.93 |
| TPSA | 140.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.64 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|