C14H19BrF2O — CID 118101207
4-bromo-1-[(2R)-3-butoxy-1,1-difluoropropan-2-yl]-2-methylbenzene (PubChem CID 118101207) has the molecular formula C14H19BrF2O and a molecular weight of 321.21 g/mol. Its IUPAC name is 4-bromo-1-[(2R)-3-butoxy-1,1-difluoropropan-2-yl]-2-methylbenzene.
| Compound Name | 4-bromo-1-[(2R)-3-butoxy-1,1-difluoropropan-2-yl]-2-methylbenzene |
|---|---|
| PubChem CID | 118101207 |
| Molecular Formula | C14H19BrF2O |
| Molecular Weight | 321.21 g/mol |
| Exact Mass | 320.06 |
| IUPAC Name | 4-bromo-1-[(2R)-3-butoxy-1,1-difluoropropan-2-yl]-2-methylbenzene |
| SMILES | CCCCOC[C@@H](c1ccc(Br)cc1C)C(F)F |
| InChI | InChI=1S/C14H19BrF2O/c1-3-4-7-18-9-13(14(16)17)12-6-5-11(15)8-10(12)2/h5-6,8,13-14H,3-4,7,9H2,1-2H3/t13-/m0/s1 |
| InChIKey | ATIYWDJRCLYYSX-ZDUSSCGKSA-N |
| XLogP | 4.92 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.21 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|