C17H24ClFN2O3 — CID 118104153
butyl 2-[[(2R)-2-[chloro(methyl)amino]propanoyl]amino]-3-(4-fluorophenyl)propanoate (PubChem CID 118104153) has the molecular formula C17H24ClFN2O3 and a molecular weight of 358.84 g/mol. Its IUPAC name is butyl 2-[[(2R)-2-[chloro(methyl)amino]propanoyl]amino]-3-(4-fluorophenyl)propanoate.
| Compound Name | butyl 2-[[(2R)-2-[chloro(methyl)amino]propanoyl]amino]-3-(4-fluorophenyl)propanoate |
|---|---|
| PubChem CID | 118104153 |
| Molecular Formula | C17H24ClFN2O3 |
| Molecular Weight | 358.84 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | butyl 2-[[(2R)-2-[chloro(methyl)amino]propanoyl]amino]-3-(4-fluorophenyl)propanoate |
| SMILES | CCCCOC(=O)C(Cc1ccc(F)cc1)NC(=O)[C@@H](C)N(C)Cl |
| InChI | InChI=1S/C17H24ClFN2O3/c1-4-5-10-24-17(23)15(20-16(22)12(2)21(3)18)11-13-6-8-14(19)9-7-13/h6-9,12,15H,4-5,10-11H2,1-3H3,(H,20,22)/t12-,15?/m1/s1 |
| InChIKey | ARUZLACIAUOTQH-KEKZHRQWSA-N |
| XLogP | 2.67 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.84 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|