C25H30N2O6S — CID 118105008
3-[3-amino-2-(oxiran-2-ylmethyl)phenyl]sulfonyl-5-methyl-2,4,6-tris(oxiran-2-ylmethyl)aniline (PubChem CID 118105008) has the molecular formula C25H30N2O6S and a molecular weight of 486.59 g/mol. Its IUPAC name is 3-[3-amino-2-(oxiran-2-ylmethyl)phenyl]sulfonyl-5-methyl-2,4,6-tris(oxiran-2-ylmethyl)aniline.
| Compound Name | 3-[3-amino-2-(oxiran-2-ylmethyl)phenyl]sulfonyl-5-methyl-2,4,6-tris(oxiran-2-ylmethyl)aniline |
|---|---|
| PubChem CID | 118105008 |
| Molecular Formula | C25H30N2O6S |
| Molecular Weight | 486.59 g/mol |
| Exact Mass | 486.18 |
| IUPAC Name | 3-[3-amino-2-(oxiran-2-ylmethyl)phenyl]sulfonyl-5-methyl-2,4,6-tris(oxiran-2-ylmethyl)aniline |
| SMILES | Cc1c(CC2CO2)c(N)c(CC2CO2)c(S(=O)(=O)c2cccc(N)c2CC2CO2)c1CC1CO1 |
| InChI | InChI=1S/C25H30N2O6S/c1-13-18(5-14-9-30-14)24(27)21(8-17-12-33-17)25(19(13)6-15-10-31-15)34(28,29)23-4-2-3-22(26)20(23)7-16-11-32-16/h2-4,14-17H,5-12,26-27H2,1H3 |
| InChIKey | OJIZHUGIVIJAPJ-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 136.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.59 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|