C25H24F3N5O4 — CID 118107195
(9S)-N-[2-(2,3-dihydroxypropoxy)-4-pyridinyl]-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide (PubChem CID 118107195) has the molecular formula C25H24F3N5O4 and a molecular weight of 515.49 g/mol. Its IUPAC name is (9S)-N-[2-(2,3-dihydroxypropoxy)-4-pyridinyl]-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide.
| Compound Name | (9S)-N-[2-(2,3-dihydroxypropoxy)-4-pyridinyl]-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
|---|---|
| PubChem CID | 118107195 |
| Molecular Formula | C25H24F3N5O4 |
| Molecular Weight | 515.49 g/mol |
| Exact Mass | 515.18 |
| IUPAC Name | (9S)-N-[2-(2,3-dihydroxypropoxy)-4-pyridinyl]-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
| SMILES | O=C(Nc1ccnc(OCC(O)CO)c1)N1c2nc(-c3cccc(C(F)(F)F)c3)ccc2N2CC[C@H]1C2 |
| InChI | InChI=1S/C25H24F3N5O4/c26-25(27,28)16-3-1-2-15(10-16)20-4-5-21-23(31-20)33(18-7-9-32(21)12-18)24(36)30-17-6-8-29-22(11-17)37-14-19(35)13-34/h1-6,8,10-11,18-19,34-35H,7,9,12-14H2,(H,29,30,36)/t18-,19?/m0/s1 |
| InChIKey | QULJSNPOYCGLAA-OYKVQYDMSA-N |
| XLogP | 3.53 |
| TPSA | 111.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.49 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |