C18H18ClF4N5O — CID 118108251
N'-[4-chloro-5-[4-(2-fluorophenyl)piperidin-1-yl]pyridazin-3-yl]-3,3,3-trifluoropropanehydrazide (PubChem CID 118108251) has the molecular formula C18H18ClF4N5O and a molecular weight of 431.82 g/mol. Its IUPAC name is N'-[4-chloro-5-[4-(2-fluorophenyl)piperidin-1-yl]pyridazin-3-yl]-3,3,3-trifluoropropanehydrazide.
| Compound Name | N'-[4-chloro-5-[4-(2-fluorophenyl)piperidin-1-yl]pyridazin-3-yl]-3,3,3-trifluoropropanehydrazide |
|---|---|
| PubChem CID | 118108251 |
| Molecular Formula | C18H18ClF4N5O |
| Molecular Weight | 431.82 g/mol |
| Exact Mass | 431.11 |
| IUPAC Name | N'-[4-chloro-5-[4-(2-fluorophenyl)piperidin-1-yl]pyridazin-3-yl]-3,3,3-trifluoropropanehydrazide |
| SMILES | O=C(CC(F)(F)F)NNc1nncc(N2CCC(c3ccccc3F)CC2)c1Cl |
| InChI | InChI=1S/C18H18ClF4N5O/c19-16-14(10-24-26-17(16)27-25-15(29)9-18(21,22)23)28-7-5-11(6-8-28)12-3-1-2-4-13(12)20/h1-4,10-11H,5-9H2,(H,25,29)(H,26,27) |
| InChIKey | XZEGTUYNDVLYOW-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.82 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|