C21H34O6Si — CID 11811681
(1S,4S,7S,8S,10R,13R,14R)-14-[tert-butyl(dimethyl)silyl]oxy-8,13-dihydroxy-2,11,11-trimethyl-5,12-dioxatetracyclo[8.2.1.14,7.01,7]tetradec-2-en-6-one (PubChem CID 11811681) has the molecular formula C21H34O6Si and a molecular weight of 410.58 g/mol. Its IUPAC name is (1S,4S,7S,8S,10R,13R,14R)-14-[tert-butyl(dimethyl)silyl]oxy-8,13-dihydroxy-2,11,11-trimethyl-5,12-dioxatetracyclo[8.2.1.14,7.01,7]tetradec-2-en-6-one.
| Compound Name | (1S,4S,7S,8S,10R,13R,14R)-14-[tert-butyl(dimethyl)silyl]oxy-8,13-dihydroxy-2,11,11-trimethyl-5,12-dioxatetracyclo[8.2.1.14,7.01,7]tetradec-2-en-6-one |
|---|---|
| PubChem CID | 11811681 |
| Molecular Formula | C21H34O6Si |
| Molecular Weight | 410.58 g/mol |
| Exact Mass | 410.21 |
| IUPAC Name | (1S,4S,7S,8S,10R,13R,14R)-14-[tert-butyl(dimethyl)silyl]oxy-8,13-dihydroxy-2,11,11-trimethyl-5,12-dioxatetracyclo[8.2.1.14,7.01,7]tetradec-2-en-6-one |
| SMILES | CC1=C[C@@H]2OC(=O)[C@@]3([C@@H](O)C[C@@H]4[C@@H](O)[C@]13OC4(C)C)[C@H]2O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H34O6Si/c1-11-9-13-16(26-28(7,8)18(2,3)4)20(17(24)25-13)14(22)10-12-15(23)21(11,20)27-19(12,5)6/h9,12-16,22-23H,10H2,1-8H3/t12-,13+,14+,15-,16+,20-,21-/m1/s1 |
| InChIKey | PUYJJCKAZCYCQO-XVCPJFELSA-N |
| XLogP | 2.54 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.58 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|