C9H17NO3 — CID 118118147
[(2R,3R)-2-methyl-4-propan-2-ylmorpholin-3-yl] formate (PubChem CID 118118147) has the molecular formula C9H17NO3 and a molecular weight of 187.24 g/mol. Its IUPAC name is [(2R,3R)-2-methyl-4-propan-2-ylmorpholin-3-yl] formate.
| Compound Name | [(2R,3R)-2-methyl-4-propan-2-ylmorpholin-3-yl] formate |
|---|---|
| PubChem CID | 118118147 |
| Molecular Formula | C9H17NO3 |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.12 |
| IUPAC Name | [(2R,3R)-2-methyl-4-propan-2-ylmorpholin-3-yl] formate |
| SMILES | CC(C)N1CCO[C@H](C)[C@H]1OC=O |
| InChI | InChI=1S/C9H17NO3/c1-7(2)10-4-5-12-8(3)9(10)13-6-11/h6-9H,4-5H2,1-3H3/t8-,9-/m1/s1 |
| InChIKey | WBZXLAJVORKGQK-RKDXNWHRSA-N |
| XLogP | 0.61 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|