C10H16N4 — CID 118121104
8-(azidomethyl)spiro[2,3,5,7-tetrahydro-1H-pyrrolizine-6,1'-cyclopropane] (PubChem CID 118121104) has the molecular formula C10H16N4 and a molecular weight of 192.27 g/mol. Its IUPAC name is 8-(azidomethyl)spiro[2,3,5,7-tetrahydro-1H-pyrrolizine-6,1'-cyclopropane].
| Compound Name | 8-(azidomethyl)spiro[2,3,5,7-tetrahydro-1H-pyrrolizine-6,1'-cyclopropane] |
|---|---|
| PubChem CID | 118121104 |
| Molecular Formula | C10H16N4 |
| Molecular Weight | 192.27 g/mol |
| Exact Mass | 192.14 |
| IUPAC Name | 8-(azidomethyl)spiro[2,3,5,7-tetrahydro-1H-pyrrolizine-6,1'-cyclopropane] |
| SMILES | [N-]=[N+]=NCC12CCCN1CC1(CC1)C2 |
| InChI | InChI=1S/C10H16N4/c11-13-12-7-10-2-1-5-14(10)8-9(6-10)3-4-9/h1-8H2 |
| InChIKey | MLVBKJKYZCMLEO-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 52.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.27 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|