C26H10F12N2 — CID 118121424
(2E)-2-[(4E)-4-(1-cyano-2,2,2-trifluoroethylidene)-2,5-bis[4-(trifluoromethyl)phenyl]cyclohexa-2,5-dien-1-ylidene]-3,3,3-trifluoropropanenitrile (PubChem CID 118121424) has the molecular formula C26H10F12N2 and a molecular weight of 578.36 g/mol. Its IUPAC name is (2E)-2-[(4E)-4-(1-cyano-2,2,2-trifluoroethylidene)-2,5-bis[4-(trifluoromethyl)phenyl]cyclohexa-2,5-dien-1-ylidene]-3,3,3-trifluoropropanenitrile.
| Compound Name | (2E)-2-[(4E)-4-(1-cyano-2,2,2-trifluoroethylidene)-2,5-bis[4-(trifluoromethyl)phenyl]cyclohexa-2,5-dien-1-ylidene]-3,3,3-trifluoropropanenitrile |
|---|---|
| PubChem CID | 118121424 |
| Molecular Formula | C26H10F12N2 |
| Molecular Weight | 578.36 g/mol |
| Exact Mass | 578.07 |
| IUPAC Name | (2E)-2-[(4E)-4-(1-cyano-2,2,2-trifluoroethylidene)-2,5-bis[4-(trifluoromethyl)phenyl]cyclohexa-2,5-dien-1-ylidene]-3,3,3-trifluoropropanenitrile |
| SMILES | N#C/C(=c1/cc(-c2ccc(C(F)(F)F)cc2)/c(=C(\C#N)C(F)(F)F)cc1-c1ccc(C(F)(F)F)cc1)C(F)(F)F |
| InChI | InChI=1S/C26H10F12N2/c27-23(28,29)15-5-1-13(2-6-15)17-9-20(22(12-40)26(36,37)38)18(10-19(17)21(11-39)25(33,34)35)14-3-7-16(8-4-14)24(30,31)32/h1-10H/b21-19+,22-20+ |
| InChIKey | NUZYUCOWXYEKKE-FLFKKZLDSA-N |
| XLogP | 7.53 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.36 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |