C17H24N4O2 — CID 118124561
tert-butyl N-[[3-(3-propan-2-ylphenyl)triazol-4-yl]methyl]carbamate (PubChem CID 118124561) has the molecular formula C17H24N4O2 and a molecular weight of 316.41 g/mol. Its IUPAC name is tert-butyl N-[[3-(3-propan-2-ylphenyl)triazol-4-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[3-(3-propan-2-ylphenyl)triazol-4-yl]methyl]carbamate |
|---|---|
| PubChem CID | 118124561 |
| Molecular Formula | C17H24N4O2 |
| Molecular Weight | 316.41 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | tert-butyl N-[[3-(3-propan-2-ylphenyl)triazol-4-yl]methyl]carbamate |
| SMILES | CC(C)c1cccc(-n2nncc2CNC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C17H24N4O2/c1-12(2)13-7-6-8-14(9-13)21-15(11-19-20-21)10-18-16(22)23-17(3,4)5/h6-9,11-12H,10H2,1-5H3,(H,18,22) |
| InChIKey | QHDSINSHDAZBRW-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.41 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |