C12H19N5O10P2 — CID 11812507
[(2R,3S,5R)-5-(2-amino-6-ethoxy-8-tritiopurin-9-yl)-2-(phosphonooxymethyl)oxolan-3-yl] dihydrogen phosphate (PubChem CID 11812507) has the molecular formula C12H19N5O10P2 and a molecular weight of 457.27 g/mol. Its IUPAC name is [(2R,3S,5R)-5-(2-amino-6-ethoxy-8-tritiopurin-9-yl)-2-(phosphonooxymethyl)oxolan-3-yl] dihydrogen phosphate.
| Compound Name | [(2R,3S,5R)-5-(2-amino-6-ethoxy-8-tritiopurin-9-yl)-2-(phosphonooxymethyl)oxolan-3-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 11812507 |
| Molecular Formula | C12H19N5O10P2 |
| Molecular Weight | 457.27 g/mol |
| Exact Mass | 457.07 |
| IUPAC Name | [(2R,3S,5R)-5-(2-amino-6-ethoxy-8-tritiopurin-9-yl)-2-(phosphonooxymethyl)oxolan-3-yl] dihydrogen phosphate |
| SMILES | [3H]c1nc2c(OCC)nc(N)nc2n1[C@H]1C[C@H](OP(=O)(O)O)[C@@H](COP(=O)(O)O)O1 |
| InChI | InChI=1S/C12H19N5O10P2/c1-2-24-11-9-10(15-12(13)16-11)17(5-14-9)8-3-6(27-29(21,22)23)7(26-8)4-25-28(18,19)20/h5-8H,2-4H2,1H3,(H2,13,15,16)(H2,18,19,20)(H2,21,22,23)/t6-,7+,8+/m0/s1/i5T |
| InChIKey | VESMCNPXPGOYCS-JFWDIUKGSA-N |
| XLogP | -0.32 |
| TPSA | 221.60 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.27 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|