C13H11NOS — CID 118125587
5-phenyl-6,7-dihydrothieno[2,3-b]pyridin-4-ol (PubChem CID 118125587) has the molecular formula C13H11NOS and a molecular weight of 229.30 g/mol. Its IUPAC name is 5-phenyl-6,7-dihydrothieno[2,3-b]pyridin-4-ol.
| Compound Name | 5-phenyl-6,7-dihydrothieno[2,3-b]pyridin-4-ol |
|---|---|
| PubChem CID | 118125587 |
| Molecular Formula | C13H11NOS |
| Molecular Weight | 229.30 g/mol |
| Exact Mass | 229.06 |
| IUPAC Name | 5-phenyl-6,7-dihydrothieno[2,3-b]pyridin-4-ol |
| SMILES | OC1=C(c2ccccc2)CNc2sccc21 |
| InChI | InChI=1S/C13H11NOS/c15-12-10-6-7-16-13(10)14-8-11(12)9-4-2-1-3-5-9/h1-7,14-15H,8H2 |
| InChIKey | KCUKSTAOQMPFBF-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.30 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |