C25H23N2O7+ — CID 11812585
ethyl 6-(1,3-benzodioxol-5-yl)-4-[3-(4-methylphenyl)-5-oxo-2H-oxadiazol-3-ium-4-yl]-2-oxocyclohex-3-ene-1-carboxylate (PubChem CID 11812585) has the molecular formula C25H23N2O7+ and a molecular weight of 463.47 g/mol. Its IUPAC name is ethyl 6-(1,3-benzodioxol-5-yl)-4-[3-(4-methylphenyl)-5-oxo-2H-oxadiazol-3-ium-4-yl]-2-oxocyclohex-3-ene-1-carboxylate.
| Compound Name | ethyl 6-(1,3-benzodioxol-5-yl)-4-[3-(4-methylphenyl)-5-oxo-2H-oxadiazol-3-ium-4-yl]-2-oxocyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 11812585 |
| Molecular Formula | C25H23N2O7+ |
| Molecular Weight | 463.47 g/mol |
| Exact Mass | 463.15 |
| IUPAC Name | ethyl 6-(1,3-benzodioxol-5-yl)-4-[3-(4-methylphenyl)-5-oxo-2H-oxadiazol-3-ium-4-yl]-2-oxocyclohex-3-ene-1-carboxylate |
| SMILES | CCOC(=O)C1C(=O)C=C(c2c(=O)o[nH][n+]2-c2ccc(C)cc2)CC1c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C25H22N2O7/c1-3-31-24(29)22-18(15-6-9-20-21(12-15)33-13-32-20)10-16(11-19(22)28)23-25(30)34-26-27(23)17-7-4-14(2)5-8-17/h4-9,11-12,18,22H,3,10,13H2,1-2H3/p+1 |
| InChIKey | BLLHJRJTHMNBIS-UHFFFAOYSA-O |
| XLogP | 2.60 |
| TPSA | 111.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.47 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|