C29H19ClN4O6 — CID 11006186
4-(1,3-benzodioxol-5-yl)-1-(2-chlorobenzoyl)-6-(5-oxo-3-phenyl-2H-oxadiazol-3-ium-4-yl)-4,5-dihydroindazol-3-olate (PubChem CID 11006186) has the molecular formula C29H19ClN4O6 and a molecular weight of 554.95 g/mol. Its IUPAC name is 4-(1,3-benzodioxol-5-yl)-1-(2-chlorobenzoyl)-6-(5-oxo-3-phenyl-2H-oxadiazol-3-ium-4-yl)-4,5-dihydroindazol-3-olate.
| Compound Name | 4-(1,3-benzodioxol-5-yl)-1-(2-chlorobenzoyl)-6-(5-oxo-3-phenyl-2H-oxadiazol-3-ium-4-yl)-4,5-dihydroindazol-3-olate |
|---|---|
| PubChem CID | 11006186 |
| Molecular Formula | C29H19ClN4O6 |
| Molecular Weight | 554.95 g/mol |
| Exact Mass | 554.10 |
| IUPAC Name | 4-(1,3-benzodioxol-5-yl)-1-(2-chlorobenzoyl)-6-(5-oxo-3-phenyl-2H-oxadiazol-3-ium-4-yl)-4,5-dihydroindazol-3-olate |
| SMILES | O=C(c1ccccc1Cl)n1nc([O-])c2c1C=C(c1c(=O)o[nH][n+]1-c1ccccc1)CC2c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C29H19ClN4O6/c30-21-9-5-4-8-19(21)28(36)34-22-13-17(26-29(37)40-32-33(26)18-6-2-1-3-7-18)12-20(25(22)27(35)31-34)16-10-11-23-24(14-16)39-15-38-23/h1-11,13-14,20H,12,15H2,(H-,31,32,35,37) |
| InChIKey | NFJJAXASRGDRJB-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 126.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.95 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|