C31H59O3P — CID 118126828
2-ethylhexyl-[2-(2-ethylhexyl)-4-nonylphenyl]-trihydroxy-λ5-phosphane (PubChem CID 118126828) has the molecular formula C31H59O3P and a molecular weight of 510.78 g/mol. Its IUPAC name is 2-ethylhexyl-[2-(2-ethylhexyl)-4-nonylphenyl]-trihydroxy-λ5-phosphane.
| Compound Name | 2-ethylhexyl-[2-(2-ethylhexyl)-4-nonylphenyl]-trihydroxy-λ5-phosphane |
|---|---|
| PubChem CID | 118126828 |
| Molecular Formula | C31H59O3P |
| Molecular Weight | 510.78 g/mol |
| Exact Mass | 510.42 |
| IUPAC Name | 2-ethylhexyl-[2-(2-ethylhexyl)-4-nonylphenyl]-trihydroxy-λ5-phosphane |
| SMILES | CCCCCCCCCc1ccc(P(O)(O)(O)CC(CC)CCCC)c(CC(CC)CCCC)c1 |
| InChI | InChI=1S/C31H59O3P/c1-6-11-14-15-16-17-18-21-29-22-23-31(30(25-29)24-27(9-4)19-12-7-2)35(32,33,34)26-28(10-5)20-13-8-3/h22-23,25,27-28,32-34H,6-21,24,26H2,1-5H3 |
| InChIKey | QWMMYFAHSJLBDZ-UHFFFAOYSA-N |
| XLogP | 8.86 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.78 |
| LogP ≤ 5 | 8.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|