C24H22BrNO4 — CID 118131310
benzyl 4-[3-(1-bromoethyl)-1-oxoisochromen-4-yl]-3,6-dihydro-2H-pyridine-1-carboxylate (PubChem CID 118131310) has the molecular formula C24H22BrNO4 and a molecular weight of 468.35 g/mol. Its IUPAC name is benzyl 4-[3-(1-bromoethyl)-1-oxoisochromen-4-yl]-3,6-dihydro-2H-pyridine-1-carboxylate.
| Compound Name | benzyl 4-[3-(1-bromoethyl)-1-oxoisochromen-4-yl]-3,6-dihydro-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 118131310 |
| Molecular Formula | C24H22BrNO4 |
| Molecular Weight | 468.35 g/mol |
| Exact Mass | 467.07 |
| IUPAC Name | benzyl 4-[3-(1-bromoethyl)-1-oxoisochromen-4-yl]-3,6-dihydro-2H-pyridine-1-carboxylate |
| SMILES | CC(Br)c1oc(=O)c2ccccc2c1C1=CCN(C(=O)OCc2ccccc2)CC1 |
| InChI | InChI=1S/C24H22BrNO4/c1-16(25)22-21(19-9-5-6-10-20(19)23(27)30-22)18-11-13-26(14-12-18)24(28)29-15-17-7-3-2-4-8-17/h2-11,16H,12-15H2,1H3 |
| InChIKey | QXDWWYHRDHECRS-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.35 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|