C34H34N6 — CID 11813396
N-anilino-N'-[5-(cyclohexylamino)-1,3-diphenylpyrazol-4-yl]benzenecarboximidamide (PubChem CID 11813396) has the molecular formula C34H34N6 and a molecular weight of 526.69 g/mol. Its IUPAC name is N-anilino-N'-[5-(cyclohexylamino)-1,3-diphenylpyrazol-4-yl]benzenecarboximidamide.
| Compound Name | N-anilino-N'-[5-(cyclohexylamino)-1,3-diphenylpyrazol-4-yl]benzenecarboximidamide |
|---|---|
| PubChem CID | 11813396 |
| Molecular Formula | C34H34N6 |
| Molecular Weight | 526.69 g/mol |
| Exact Mass | 526.28 |
| IUPAC Name | N-anilino-N'-[5-(cyclohexylamino)-1,3-diphenylpyrazol-4-yl]benzenecarboximidamide |
| SMILES | c1ccc(NN/C(=N/c2c(-c3ccccc3)nn(-c3ccccc3)c2NC2CCCCC2)c2ccccc2)cc1 |
| InChI | InChI=1S/C34H34N6/c1-6-16-26(17-7-1)31-32(36-33(27-18-8-2-9-19-27)38-37-29-22-12-4-13-23-29)34(35-28-20-10-3-11-21-28)40(39-31)30-24-14-5-15-25-30/h1-2,4-9,12-19,22-25,28,35,37H,3,10-11,20-21H2,(H,36,38) |
| InChIKey | VYJDRBVEFSIVNP-UHFFFAOYSA-N |
| XLogP | 7.98 |
| TPSA | 66.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.69 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|