C18H25N3O5S — CID 118138666
3-[4-[(N-methyl-C-methylsulfanylcarbonimidoyl)carbamoyl]phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (PubChem CID 118138666) has the molecular formula C18H25N3O5S and a molecular weight of 395.48 g/mol. Its IUPAC name is 3-[4-[(N-methyl-C-methylsulfanylcarbonimidoyl)carbamoyl]phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid.
| Compound Name | 3-[4-[(N-methyl-C-methylsulfanylcarbonimidoyl)carbamoyl]phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
|---|---|
| PubChem CID | 118138666 |
| Molecular Formula | C18H25N3O5S |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | 3-[4-[(N-methyl-C-methylsulfanylcarbonimidoyl)carbamoyl]phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| SMILES | C/N=C(/NC(=O)c1ccc(CC(NC(=O)OC(C)(C)C)C(=O)O)cc1)SC |
| InChI | InChI=1S/C18H25N3O5S/c1-18(2,3)26-17(25)20-13(15(23)24)10-11-6-8-12(9-7-11)14(22)21-16(19-4)27-5/h6-9,13H,10H2,1-5H3,(H,20,25)(H,23,24)(H,19,21,22) |
| InChIKey | VSRVETAXLSZMDX-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 117.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|